C22H31ClN2O3S — CID 69473621
4-chloro-N-(3,7-dimethylocta-2,6-dienyl)-N-(2-oxoazepan-3-yl)benzenesulfonamide (PubChem CID 69473621) has the molecular formula C22H31ClN2O3S and a molecular weight of 439.02 g/mol. Its IUPAC name is 4-chloro-N-(3,7-dimethylocta-2,6-dienyl)-N-(2-oxoazepan-3-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(3,7-dimethylocta-2,6-dienyl)-N-(2-oxoazepan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 69473621 |
| Molecular Formula | C22H31ClN2O3S |
| Molecular Weight | 439.02 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-chloro-N-(3,7-dimethylocta-2,6-dienyl)-N-(2-oxoazepan-3-yl)benzenesulfonamide |
| SMILES | CC(C)=CCCC(C)=CCN(C1CCCCNC1=O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H31ClN2O3S/c1-17(2)7-6-8-18(3)14-16-25(21-9-4-5-15-24-22(21)26)29(27,28)20-12-10-19(23)11-13-20/h7,10-14,21H,4-6,8-9,15-16H2,1-3H3,(H,24,26) |
| InChIKey | UZVWXDNAORAQAX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.02 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|