About 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate
6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate (PubChem CID 6947394) has the molecular formula C13H15NO4-2
and a molecular weight of 249.27 g/mol. Its IUPAC name is 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate.
Molecular Properties
| Compound Name | 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate |
| PubChem CID | 6947394 |
| Molecular Formula | C13H15NO4-2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate |
| SMILES | CCc1nc(C(C)(C)C)cc(C(=O)[O-])c1C(=O)[O-] |
| InChI | InChI=1S/C13H17NO4/c1-5-8-10(12(17)18)7(11(15)16)6-9(14-8)13(2,3)4/h6H,5H2,1-4H3,(H,15,16)(H,17,18)/p-2 |
| InChIKey | LFIAGOQGOGKRGE-UHFFFAOYSA-L |
| XLogP | -0.33 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate?
The IUPAC name of 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate (CID 6947394) is 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate.
What is the SMILES notation for 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate?
The canonical SMILES for 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate is CCc1nc(C(C)(C)C)cc(C(=O)[O-])c1C(=O)[O-].
What is the InChIKey of 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate?
The InChIKey is LFIAGOQGOGKRGE-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H17NO4/c1-5-8-10(12(17)18)7(11(15)16)6-9(14-8)13(2,3)4/h6H,5H2,1-4H3,(H,15,16)(H,17,18)/p-2.
What are the key properties of 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate?
6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate has a molecular weight of 249.27 g/mol, XLogP of -0.33, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-ethylpyridine-3,4-dicarboxylate is sourced from PubChem (CID 6947394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).