About 4-methoxycyclohepta-1,3,5-triene-1-carboxylate
4-methoxycyclohepta-1,3,5-triene-1-carboxylate (PubChem CID 6947398) has the molecular formula C9H9O3-
and a molecular weight of 165.17 g/mol. Its IUPAC name is 4-methoxycyclohepta-1,3,5-triene-1-carboxylate.
Molecular Properties
| Compound Name | 4-methoxycyclohepta-1,3,5-triene-1-carboxylate |
| PubChem CID | 6947398 |
| Molecular Formula | C9H9O3- |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 4-methoxycyclohepta-1,3,5-triene-1-carboxylate |
| SMILES | COC1=CC=C(C(=O)[O-])CC=C1 |
| InChI | InChI=1S/C9H10O3/c1-12-8-4-2-3-7(5-6-8)9(10)11/h2,4-6H,3H2,1H3,(H,10,11)/p-1 |
| InChIKey | ZUZCCIAFURUZTI-UHFFFAOYSA-M |
| XLogP | 0.15 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxycyclohepta-1,3,5-triene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxycyclohepta-1,3,5-triene-1-carboxylate?
The IUPAC name of 4-methoxycyclohepta-1,3,5-triene-1-carboxylate (CID 6947398) is 4-methoxycyclohepta-1,3,5-triene-1-carboxylate.
What is the SMILES notation for 4-methoxycyclohepta-1,3,5-triene-1-carboxylate?
The canonical SMILES for 4-methoxycyclohepta-1,3,5-triene-1-carboxylate is COC1=CC=C(C(=O)[O-])CC=C1.
What is the InChIKey of 4-methoxycyclohepta-1,3,5-triene-1-carboxylate?
The InChIKey is ZUZCCIAFURUZTI-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10O3/c1-12-8-4-2-3-7(5-6-8)9(10)11/h2,4-6H,3H2,1H3,(H,10,11)/p-1.
What are the key properties of 4-methoxycyclohepta-1,3,5-triene-1-carboxylate?
4-methoxycyclohepta-1,3,5-triene-1-carboxylate has a molecular weight of 165.17 g/mol, XLogP of 0.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxycyclohepta-1,3,5-triene-1-carboxylate is sourced from PubChem (CID 6947398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).