C29H29F3N2O4 — CID 69475449
methyl (2R)-2-[[2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-phenylacetate (PubChem CID 69475449) has the molecular formula C29H29F3N2O4 and a molecular weight of 526.56 g/mol. Its IUPAC name is methyl (2R)-2-[[2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-phenylacetate.
| Compound Name | methyl (2R)-2-[[2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 69475449 |
| Molecular Formula | C29H29F3N2O4 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | methyl (2R)-2-[[2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-phenylacetate |
| SMILES | COC(=O)[C@H](NC(=O)c1cc2c(n(Cc3ccc(C(F)(F)F)cc3)c1=O)CCCCCC2)c1ccccc1 |
| InChI | InChI=1S/C29H29F3N2O4/c1-38-28(37)25(20-9-6-4-7-10-20)33-26(35)23-17-21-11-5-2-3-8-12-24(21)34(27(23)36)18-19-13-15-22(16-14-19)29(30,31)32/h4,6-7,9-10,13-17,25H,2-3,5,8,11-12,18H2,1H3,(H,33,35)/t25-/m1/s1 |
| InChIKey | XJZWHYBWMIEBAY-RUZDIDTESA-N |
| XLogP | 5.22 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |