About 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol
3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol (PubChem CID 69475548) has the molecular formula C10H20OSi
and a molecular weight of 184.35 g/mol. Its IUPAC name is 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol.
Molecular Properties
| Compound Name | 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol |
| PubChem CID | 69475548 |
| Molecular Formula | C10H20OSi |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol |
| SMILES | C[Si]1(C)CCC(=CCCO)CC1 |
| InChI | InChI=1S/C10H20OSi/c1-12(2)8-5-10(6-9-12)4-3-7-11/h4,11H,3,5-9H2,1-2H3 |
| InChIKey | LRMZLZHYUPZPOZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol?
The IUPAC name of 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol (CID 69475548) is 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol.
What is the SMILES notation for 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol?
The canonical SMILES for 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol is C[Si]1(C)CCC(=CCCO)CC1.
What is the InChIKey of 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol?
The InChIKey is LRMZLZHYUPZPOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20OSi/c1-12(2)8-5-10(6-9-12)4-3-7-11/h4,11H,3,5-9H2,1-2H3.
What are the key properties of 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol?
3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol has a molecular weight of 184.35 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dimethylsilinan-4-ylidene)propan-1-ol is sourced from PubChem (CID 69475548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).