About ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate
ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate (PubChem CID 69475722) has the molecular formula C17H26N2O4
and a molecular weight of 322.41 g/mol. Its IUPAC name is ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate |
| PubChem CID | 69475722 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate |
| SMILES | CCCCn1c(C)c(C)cc(C(=O)NCCC(=O)OCC)c1=O |
| InChI | InChI=1S/C17H26N2O4/c1-5-7-10-19-13(4)12(3)11-14(17(19)22)16(21)18-9-8-15(20)23-6-2/h11H,5-10H2,1-4H3,(H,18,21) |
| InChIKey | GUGKWPYTCJVPDY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate?
The IUPAC name of ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate (CID 69475722) is ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate.
What is the SMILES notation for ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate?
The canonical SMILES for ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate is CCCCn1c(C)c(C)cc(C(=O)NCCC(=O)OCC)c1=O.
What is the InChIKey of ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate?
The InChIKey is GUGKWPYTCJVPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O4/c1-5-7-10-19-13(4)12(3)11-14(17(19)22)16(21)18-9-8-15(20)23-6-2/h11H,5-10H2,1-4H3,(H,18,21).
What are the key properties of ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate?
ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate has a molecular weight of 322.41 g/mol, XLogP of 1.95, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]propanoate is sourced from PubChem (CID 69475722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).