About 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine
8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine (PubChem CID 69475838) has the molecular formula C16H15ClN6S3
and a molecular weight of 422.99 g/mol. Its IUPAC name is 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine.
Molecular Properties
| Compound Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine |
| PubChem CID | 69475838 |
| Molecular Formula | C16H15ClN6S3 |
| Molecular Weight | 422.99 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine |
| SMILES | CCSCCn1c(Sc2nc3cccc(Cl)c3s2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C16H15ClN6S3/c1-2-24-7-6-23-14-11(13(18)19-8-20-14)22-15(23)26-16-21-10-5-3-4-9(17)12(10)25-16/h3-5,8H,2,6-7H2,1H3,(H2,18,19,20) |
| InChIKey | PBVHKHPEKROZFM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.99 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine?
The IUPAC name of 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine (CID 69475838) is 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine.
What is the SMILES notation for 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine?
The canonical SMILES for 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine is CCSCCn1c(Sc2nc3cccc(Cl)c3s2)nc2c(N)ncnc21.
What is the InChIKey of 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine?
The InChIKey is PBVHKHPEKROZFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN6S3/c1-2-24-7-6-23-14-11(13(18)19-8-20-14)22-15(23)26-16-21-10-5-3-4-9(17)12(10)25-16/h3-5,8H,2,6-7H2,1H3,(H2,18,19,20).
What are the key properties of 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine?
8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine has a molecular weight of 422.99 g/mol, XLogP of 4.58, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-ethylsulfanylethyl)purin-6-amine is sourced from PubChem (CID 69475838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).