About 3-(azepan-2-yl)propanoic acid
3-(azepan-2-yl)propanoic acid (PubChem CID 69475849) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-(azepan-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(azepan-2-yl)propanoic acid |
| PubChem CID | 69475849 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 3-(azepan-2-yl)propanoic acid |
| SMILES | O=C(O)CCC1CCCCCN1 |
| InChI | InChI=1S/C9H17NO2/c11-9(12)6-5-8-4-2-1-3-7-10-8/h8,10H,1-7H2,(H,11,12) |
| InChIKey | WGVWEMIHRBKVPK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(azepan-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azepan-2-yl)propanoic acid?
The IUPAC name of 3-(azepan-2-yl)propanoic acid (CID 69475849) is 3-(azepan-2-yl)propanoic acid.
What is the SMILES notation for 3-(azepan-2-yl)propanoic acid?
The canonical SMILES for 3-(azepan-2-yl)propanoic acid is O=C(O)CCC1CCCCCN1.
What is the InChIKey of 3-(azepan-2-yl)propanoic acid?
The InChIKey is WGVWEMIHRBKVPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c11-9(12)6-5-8-4-2-1-3-7-10-8/h8,10H,1-7H2,(H,11,12).
What are the key properties of 3-(azepan-2-yl)propanoic acid?
3-(azepan-2-yl)propanoic acid has a molecular weight of 171.24 g/mol, XLogP of 1.38, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azepan-2-yl)propanoic acid is sourced from PubChem (CID 69475849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).