C7H12N6 — CID 69476045
4-N-prop-2-enylpyrimidine-2,4,5,6-tetramine (PubChem CID 69476045) has the molecular formula C7H12N6 and a molecular weight of 180.21 g/mol. Its IUPAC name is 4-N-prop-2-enylpyrimidine-2,4,5,6-tetramine.
| Compound Name | 4-N-prop-2-enylpyrimidine-2,4,5,6-tetramine |
|---|---|
| PubChem CID | 69476045 |
| Molecular Formula | C7H12N6 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 4-N-prop-2-enylpyrimidine-2,4,5,6-tetramine |
| SMILES | C=CCNc1nc(N)nc(N)c1N |
| InChI | InChI=1S/C7H12N6/c1-2-3-11-6-4(8)5(9)12-7(10)13-6/h2H,1,3,8H2,(H5,9,10,11,12,13) |
| InChIKey | LWHWLGTVMCZOGS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|