About 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid
4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid (PubChem CID 69476522) has the molecular formula C12H21F2NO2
and a molecular weight of 249.30 g/mol. Its IUPAC name is 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid |
| PubChem CID | 69476522 |
| Molecular Formula | C12H21F2NO2 |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CC(CCCCC(F)F)CCN1 |
| InChI | InChI=1S/C12H21F2NO2/c1-12(11(16)17)8-9(6-7-15-12)4-2-3-5-10(13)14/h9-10,15H,2-8H2,1H3,(H,16,17) |
| InChIKey | AVGLXZVRKKTFEL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid?
The IUPAC name of 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid (CID 69476522) is 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid.
What is the SMILES notation for 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid?
The canonical SMILES for 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid is CC1(C(=O)O)CC(CCCCC(F)F)CCN1.
What is the InChIKey of 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid?
The InChIKey is AVGLXZVRKKTFEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO2/c1-12(11(16)17)8-9(6-7-15-12)4-2-3-5-10(13)14/h9-10,15H,2-8H2,1H3,(H,16,17).
What are the key properties of 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid?
4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid has a molecular weight of 249.30 g/mol, XLogP of 2.65, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,5-difluoropentyl)-2-methylpiperidine-2-carboxylic acid is sourced from PubChem (CID 69476522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).