About 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline
4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline (PubChem CID 69476709) has the molecular formula C22H19N3OS
and a molecular weight of 373.48 g/mol. Its IUPAC name is 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline.
Molecular Properties
| Compound Name | 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline |
| PubChem CID | 69476709 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline |
| SMILES | Cc1ccc(-c2ncco2)cc1-c1ccc(NN=Cc2sccc2C)cc1 |
| InChI | InChI=1S/C22H19N3OS/c1-15-3-4-18(22-23-10-11-26-22)13-20(15)17-5-7-19(8-6-17)25-24-14-21-16(2)9-12-27-21/h3-14,25H,1-2H3 |
| InChIKey | RVTVKNRYJRLROB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_thiophene_B(4)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline?
The IUPAC name of 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline (CID 69476709) is 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline.
What is the SMILES notation for 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline?
The canonical SMILES for 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline is Cc1ccc(-c2ncco2)cc1-c1ccc(NN=Cc2sccc2C)cc1.
What is the InChIKey of 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline?
The InChIKey is RVTVKNRYJRLROB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3OS/c1-15-3-4-18(22-23-10-11-26-22)13-20(15)17-5-7-19(8-6-17)25-24-14-21-16(2)9-12-27-21/h3-14,25H,1-2H3.
What are the key properties of 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline?
4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline has a molecular weight of 373.48 g/mol, XLogP of 6.13, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-N-[(3-methylthiophen-2-yl)methylideneamino]aniline is sourced from PubChem (CID 69476709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).