C22H21FN2O4 — CID 69476732
N-[(4-fluorophenyl)methyl]-3-(methoxymethoxy)-2-phenylmethoxypyridine-4-carboxamide (PubChem CID 69476732) has the molecular formula C22H21FN2O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-(methoxymethoxy)-2-phenylmethoxypyridine-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-(methoxymethoxy)-2-phenylmethoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 69476732 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-(methoxymethoxy)-2-phenylmethoxypyridine-4-carboxamide |
| SMILES | COCOc1c(C(=O)NCc2ccc(F)cc2)ccnc1OCc1ccccc1 |
| InChI | InChI=1S/C22H21FN2O4/c1-27-15-29-20-19(21(26)25-13-16-7-9-18(23)10-8-16)11-12-24-22(20)28-14-17-5-3-2-4-6-17/h2-12H,13-15H2,1H3,(H,25,26) |
| InChIKey | RXZYNEOPPKESLQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|