About 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine
9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine (PubChem CID 69476768) has the molecular formula C12H14N6
and a molecular weight of 242.29 g/mol. Its IUPAC name is 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine.
Molecular Properties
| Compound Name | 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine |
| PubChem CID | 69476768 |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine |
| SMILES | Cc1ccc(-n2cnc3c2NC(N)=NC3N)cc1 |
| InChI | InChI=1S/C12H14N6/c1-7-2-4-8(5-3-7)18-6-15-9-10(13)16-12(14)17-11(9)18/h2-6,10H,13H2,1H3,(H3,14,16,17) |
| InChIKey | WLICXZAKTGGKRK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine?
The IUPAC name of 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine (CID 69476768) is 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine.
What is the SMILES notation for 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine?
The canonical SMILES for 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine is Cc1ccc(-n2cnc3c2NC(N)=NC3N)cc1.
What is the InChIKey of 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine?
The InChIKey is WLICXZAKTGGKRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N6/c1-7-2-4-8(5-3-7)18-6-15-9-10(13)16-12(14)17-11(9)18/h2-6,10H,13H2,1H3,(H3,14,16,17).
What are the key properties of 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine?
9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine has a molecular weight of 242.29 g/mol, XLogP of 0.88, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-methylphenyl)-3,6-dihydropurine-2,6-diamine is sourced from PubChem (CID 69476768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).