C9H4N4O — CID 69477024
3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1(13),2,4,6,8,11-hexaen-10-one (PubChem CID 69477024) has the molecular formula C9H4N4O and a molecular weight of 184.16 g/mol. Its IUPAC name is 3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1(13),2,4,6,8,11-hexaen-10-one.
| Compound Name | 3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1(13),2,4,6,8,11-hexaen-10-one |
|---|---|
| PubChem CID | 69477024 |
| Molecular Formula | C9H4N4O |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1(13),2,4,6,8,11-hexaen-10-one |
| SMILES | O=c1ccc2c3c(ncnc3n1)N=C2 |
| InChI | InChI=1S/C9H4N4O/c14-6-2-1-5-3-10-8-7(5)9(13-6)12-4-11-8/h1-4H |
| InChIKey | CUDLSLSILVMITR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 68.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |