C6H8N4O — CID 69477152
3,4,6,8-tetrahydro-2H-pteridin-7-one (PubChem CID 69477152) has the molecular formula C6H8N4O and a molecular weight of 152.16 g/mol. Its IUPAC name is 3,4,6,8-tetrahydro-2H-pteridin-7-one.
| Compound Name | 3,4,6,8-tetrahydro-2H-pteridin-7-one |
|---|---|
| PubChem CID | 69477152 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 3,4,6,8-tetrahydro-2H-pteridin-7-one |
| SMILES | O=C1CN=C2CNCN=C2N1 |
| InChI | InChI=1S/C6H8N4O/c11-5-2-8-4-1-7-3-9-6(4)10-5/h7H,1-3H2,(H,9,10,11) |
| InChIKey | ICRVYCIIYYZHJS-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |