About spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide
spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide (PubChem CID 69477895) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide.
Molecular Properties
| Compound Name | spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide |
| PubChem CID | 69477895 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide |
| SMILES | NC(=O)N1CCC2(C1)OCc1ccccc12 |
| InChI | InChI=1S/C12H14N2O2/c13-11(15)14-6-5-12(8-14)10-4-2-1-3-9(10)7-16-12/h1-4H,5-8H2,(H2,13,15) |
| InChIKey | RGZHCSVSCNHNIW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide?
The IUPAC name of spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide (CID 69477895) is spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide.
What is the SMILES notation for spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide?
The canonical SMILES for spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide is NC(=O)N1CCC2(C1)OCc1ccccc12.
What is the InChIKey of spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide?
The InChIKey is RGZHCSVSCNHNIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c13-11(15)14-6-5-12(8-14)10-4-2-1-3-9(10)7-16-12/h1-4H,5-8H2,(H2,13,15).
What are the key properties of spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide?
spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide has a molecular weight of 218.26 g/mol, XLogP of 1.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carboxamide is sourced from PubChem (CID 69477895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).