C13H10N2O — CID 69478155
4-oxa-6,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,7,9,11,13,15-hexaene (PubChem CID 69478155) has the molecular formula C13H10N2O and a molecular weight of 210.24 g/mol. Its IUPAC name is 4-oxa-6,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,7,9,11,13,15-hexaene.
| Compound Name | 4-oxa-6,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,7,9,11,13,15-hexaene |
|---|---|
| PubChem CID | 69478155 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 4-oxa-6,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,7,9,11,13,15-hexaene |
| SMILES | c1ccc2c3ccn4c(c-3nc2c1)COC4 |
| InChI | InChI=1S/C13H10N2O/c1-2-4-11-9(3-1)10-5-6-15-8-16-7-12(15)13(10)14-11/h1-6H,7-8H2 |
| InChIKey | DWCMBBNBICLXEY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |