About 4,5-difluorophthalate
4,5-difluorophthalate (PubChem CID 6947827) has the molecular formula C8H2F2O4-2
and a molecular weight of 200.10 g/mol. Its IUPAC name is 4,5-difluorophthalate.
Molecular Properties
| Compound Name | 4,5-difluorophthalate |
| PubChem CID | 6947827 |
| Molecular Formula | C8H2F2O4-2 |
| Molecular Weight | 200.10 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 4,5-difluorophthalate |
| SMILES | O=C([O-])c1cc(F)c(F)cc1C(=O)[O-] |
| InChI | InChI=1S/C8H4F2O4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2H,(H,11,12)(H,13,14)/p-2 |
| InChIKey | FFSBOABNRUJQFW-UHFFFAOYSA-L |
| XLogP | -1.31 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.10 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-difluorophthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-difluorophthalate?
The IUPAC name of 4,5-difluorophthalate (CID 6947827) is 4,5-difluorophthalate.
What is the SMILES notation for 4,5-difluorophthalate?
The canonical SMILES for 4,5-difluorophthalate is O=C([O-])c1cc(F)c(F)cc1C(=O)[O-].
What is the InChIKey of 4,5-difluorophthalate?
The InChIKey is FFSBOABNRUJQFW-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H4F2O4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2H,(H,11,12)(H,13,14)/p-2.
What are the key properties of 4,5-difluorophthalate?
4,5-difluorophthalate has a molecular weight of 200.10 g/mol, XLogP of -1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluorophthalate is sourced from PubChem (CID 6947827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).