C14H20N4 — CID 69478668
(2Z,6Z,9Z,13Z)-5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradeca-2,4,6,9,11,13-hexaene (PubChem CID 69478668) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is (2Z,6Z,9Z,13Z)-5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradeca-2,4,6,9,11,13-hexaene.
| Compound Name | (2Z,6Z,9Z,13Z)-5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradeca-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 69478668 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (2Z,6Z,9Z,13Z)-5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradeca-2,4,6,9,11,13-hexaene |
| SMILES | C/C1=C/C(C)=N/C=C\N/C(C)=C\C(C)=N\C=C/N1 |
| InChI | InChI=1S/C14H20N4/c1-11-9-12(2)16-7-8-18-14(4)10-13(3)17-6-5-15-11/h5-10,15,18H,1-4H3/b6-5-,8-7-,11-9-,14-10-,16-12+,17-13+ |
| InChIKey | UAKOFIPGNUKVQH-LMOLCXRYSA-N |
| XLogP | 2.85 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |