C43H31F3N6O8 — CID 69478809
2-[3-[(E)-2-cyano-3-(3-methoxycarbonylanilino)-3-oxoprop-1-enyl]indol-1-yl]acetic acid;2-[3-[2-cyano-3-oxo-3-[4-(trifluoromethyl)anilino]prop-1-enyl]indol-1-yl]acetic acid (PubChem CID 69478809) has the molecular formula C43H31F3N6O8 and a molecular weight of 816.75 g/mol. Its IUPAC name is 2-[3-[(E)-2-cyano-3-(3-methoxycarbonylanilino)-3-oxoprop-1-enyl]indol-1-yl]acetic acid;2-[3-[2-cyano-3-oxo-3-[4-(trifluoromethyl)anilino]prop-1-enyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[(E)-2-cyano-3-(3-methoxycarbonylanilino)-3-oxoprop-1-enyl]indol-1-yl]acetic acid;2-[3-[2-cyano-3-oxo-3-[4-(trifluoromethyl)anilino]prop-1-enyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 69478809 |
| Molecular Formula | C43H31F3N6O8 |
| Molecular Weight | 816.75 g/mol |
| Exact Mass | 816.22 |
| IUPAC Name | 2-[3-[(E)-2-cyano-3-(3-methoxycarbonylanilino)-3-oxoprop-1-enyl]indol-1-yl]acetic acid;2-[3-[2-cyano-3-oxo-3-[4-(trifluoromethyl)anilino]prop-1-enyl]indol-1-yl]acetic acid |
| SMILES | COC(=O)c1cccc(NC(=O)/C(C#N)=C/c2cn(CC(=O)O)c3ccccc23)c1.N#CC(=Cc1cn(CC(=O)O)c2ccccc12)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H17N3O5.C21H14F3N3O3/c1-30-22(29)14-5-4-6-17(10-14)24-21(28)15(11-23)9-16-12-25(13-20(26)27)19-8-3-2-7-18(16)19;22-21(23,24)15-5-7-16(8-6-15)26-20(30)13(10-25)9-14-11-27(12-19(28)29)18-4-2-1-3-17(14)18/h2-10,12H,13H2,1H3,(H,24,28)(H,26,27);1-9,11H,12H2,(H,26,30)(H,28,29)/b15-9+; |
| InChIKey | AKTIGYJYGJMYGX-NSPIFIKESA-N |
| XLogP | 7.35 |
| TPSA | 216.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.75 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|