About 2H-pyrrolo[3,4-b]quinoline;hydrochloride
2H-pyrrolo[3,4-b]quinoline;hydrochloride (PubChem CID 69479066) has the molecular formula C11H9ClN2
and a molecular weight of 204.66 g/mol. Its IUPAC name is 2H-pyrrolo[3,4-b]quinoline;hydrochloride.
Molecular Properties
| Compound Name | 2H-pyrrolo[3,4-b]quinoline;hydrochloride |
| PubChem CID | 69479066 |
| Molecular Formula | C11H9ClN2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 2H-pyrrolo[3,4-b]quinoline;hydrochloride |
| SMILES | Cl.c1ccc2nc3c[nH]cc3cc2c1 |
| InChI | InChI=1S/C11H8N2.ClH/c1-2-4-10-8(3-1)5-9-6-12-7-11(9)13-10;/h1-7,12H;1H |
| InChIKey | NQQZVLXPRFFVNV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-pyrrolo[3,4-b]quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrrolo[3,4-b]quinoline;hydrochloride?
The IUPAC name of 2H-pyrrolo[3,4-b]quinoline;hydrochloride (CID 69479066) is 2H-pyrrolo[3,4-b]quinoline;hydrochloride.
What is the SMILES notation for 2H-pyrrolo[3,4-b]quinoline;hydrochloride?
The canonical SMILES for 2H-pyrrolo[3,4-b]quinoline;hydrochloride is Cl.c1ccc2nc3c[nH]cc3cc2c1.
What is the InChIKey of 2H-pyrrolo[3,4-b]quinoline;hydrochloride?
The InChIKey is NQQZVLXPRFFVNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2.ClH/c1-2-4-10-8(3-1)5-9-6-12-7-11(9)13-10;/h1-7,12H;1H.
What are the key properties of 2H-pyrrolo[3,4-b]quinoline;hydrochloride?
2H-pyrrolo[3,4-b]quinoline;hydrochloride has a molecular weight of 204.66 g/mol, XLogP of 3.14, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrrolo[3,4-b]quinoline;hydrochloride is sourced from PubChem (CID 69479066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).