C19H22ClN5O4 — CID 69479090
2-(4-chlorophenyl)-1-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]piperazin-1-yl]ethanone (PubChem CID 69479090) has the molecular formula C19H22ClN5O4 and a molecular weight of 419.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 69479090 |
| Molecular Formula | C19H22ClN5O4 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]piperazin-1-yl]ethanone |
| SMILES | C[C@]1(CN2CCN(C(=O)Cc3ccc(Cl)cc3)CC2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C19H22ClN5O4/c1-19(13-24-11-16(25(27)28)21-18(24)29-19)12-22-6-8-23(9-7-22)17(26)10-14-2-4-15(20)5-3-14/h2-5,11H,6-10,12-13H2,1H3/t19-/m0/s1 |
| InChIKey | WJARGFHDNUIPQC-IBGZPJMESA-N |
| XLogP | 1.98 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|