C23H31ClN6O3 — CID 69479658
(2S)-2-[[4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 69479658) has the molecular formula C23H31ClN6O3 and a molecular weight of 474.99 g/mol. Its IUPAC name is (2S)-2-[[4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2S)-2-[[4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 69479658 |
| Molecular Formula | C23H31ClN6O3 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (2S)-2-[[4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@]1(CN2CCN(C3CCN(Cc4ccc(Cl)cc4)CC3)CC2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C23H31ClN6O3/c1-23(17-29-15-21(30(31)32)25-22(29)33-23)16-27-10-12-28(13-11-27)20-6-8-26(9-7-20)14-18-2-4-19(24)5-3-18/h2-5,15,20H,6-14,16-17H2,1H3/t23-/m0/s1 |
| InChIKey | MXJBEBRCUTXSTP-QHCPKHFHSA-N |
| XLogP | 2.88 |
| TPSA | 79.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|