C24H26F3N2O4S2+ — CID 69479839
[1-methyl-1-(3-pyrrol-1-ylpropyl)pyrrolidin-1-ium-3-yl] 2,2-dithiophen-2-yl-2-(2,2,2-trifluoroacetyl)oxyacetate (PubChem CID 69479839) has the molecular formula C24H26F3N2O4S2+ and a molecular weight of 527.61 g/mol. Its IUPAC name is [1-methyl-1-(3-pyrrol-1-ylpropyl)pyrrolidin-1-ium-3-yl] 2,2-dithiophen-2-yl-2-(2,2,2-trifluoroacetyl)oxyacetate.
| Compound Name | [1-methyl-1-(3-pyrrol-1-ylpropyl)pyrrolidin-1-ium-3-yl] 2,2-dithiophen-2-yl-2-(2,2,2-trifluoroacetyl)oxyacetate |
|---|---|
| PubChem CID | 69479839 |
| Molecular Formula | C24H26F3N2O4S2+ |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | [1-methyl-1-(3-pyrrol-1-ylpropyl)pyrrolidin-1-ium-3-yl] 2,2-dithiophen-2-yl-2-(2,2,2-trifluoroacetyl)oxyacetate |
| SMILES | C[N+]1(CCCn2cccc2)CCC(OC(=O)C(OC(=O)C(F)(F)F)(c2cccs2)c2cccs2)C1 |
| InChI | InChI=1S/C24H26F3N2O4S2/c1-29(13-6-12-28-10-2-3-11-28)14-9-18(17-29)32-21(30)23(19-7-4-15-34-19,20-8-5-16-35-20)33-22(31)24(25,26)27/h2-5,7-8,10-11,15-16,18H,6,9,12-14,17H2,1H3/q+1 |
| InChIKey | GZRUIMSGSLTWKU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|