About 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane
3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane (PubChem CID 69479887) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane.
Molecular Properties
| Compound Name | 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane |
| PubChem CID | 69479887 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane |
| SMILES | C=CCOCC1COC2(CCCCCO2)O1 |
| InChI | InChI=1S/C12H20O4/c1-2-7-13-9-11-10-15-12(16-11)6-4-3-5-8-14-12/h2,11H,1,3-10H2 |
| InChIKey | WVOGSKIPPJBXRP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane?
The IUPAC name of 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane (CID 69479887) is 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane.
What is the SMILES notation for 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane?
The canonical SMILES for 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane is C=CCOCC1COC2(CCCCCO2)O1.
What is the InChIKey of 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane?
The InChIKey is WVOGSKIPPJBXRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-2-7-13-9-11-10-15-12(16-11)6-4-3-5-8-14-12/h2,11H,1,3-10H2.
What are the key properties of 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane?
3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane has a molecular weight of 228.29 g/mol, XLogP of 1.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(prop-2-enoxymethyl)-1,4,11-trioxaspiro[4.6]undecane is sourced from PubChem (CID 69479887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).