C38H70NO2+ — CID 69480063
2,3,4-tris-decyl-5,6-dimethylpyridin-1-ium-1-carboxylic acid (PubChem CID 69480063) has the molecular formula C38H70NO2+ and a molecular weight of 572.98 g/mol. Its IUPAC name is 2,3,4-tris-decyl-5,6-dimethylpyridin-1-ium-1-carboxylic acid.
| Compound Name | 2,3,4-tris-decyl-5,6-dimethylpyridin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 69480063 |
| Molecular Formula | C38H70NO2+ |
| Molecular Weight | 572.98 g/mol |
| Exact Mass | 572.54 |
| IUPAC Name | 2,3,4-tris-decyl-5,6-dimethylpyridin-1-ium-1-carboxylic acid |
| SMILES | CCCCCCCCCCc1c(C)c(C)[n+](C(=O)O)c(CCCCCCCCCC)c1CCCCCCCCCC |
| InChI | InChI=1S/C38H69NO2/c1-6-9-12-15-18-21-24-27-30-35-33(4)34(5)39(38(40)41)37(32-29-26-23-20-17-14-11-8-3)36(35)31-28-25-22-19-16-13-10-7-2/h6-32H2,1-5H3/p+1 |
| InChIKey | VUUNZNAFGUHVBZ-UHFFFAOYSA-O |
| XLogP | 12.17 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.98 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|