C32H31FN4O6 — CID 69480136
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-N-(3-propan-2-yloxypropyl)-1,5-naphthyridine-3-carboxamide (PubChem CID 69480136) has the molecular formula C32H31FN4O6 and a molecular weight of 586.62 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-N-(3-propan-2-yloxypropyl)-1,5-naphthyridine-3-carboxamide.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-N-(3-propan-2-yloxypropyl)-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 69480136 |
| Molecular Formula | C32H31FN4O6 |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-N-(3-propan-2-yloxypropyl)-1,5-naphthyridine-3-carboxamide |
| SMILES | CC(C)OCCCNC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3)cc2n(CCN2C(=O)c3ccccc3C2=O)c1=O |
| InChI | InChI=1S/C32H31FN4O6/c1-19(2)43-15-5-12-34-29(39)26-28(38)27-25(17-21(18-35-27)16-20-8-10-22(33)11-9-20)36(32(26)42)13-14-37-30(40)23-6-3-4-7-24(23)31(37)41/h3-4,6-11,17-19,38H,5,12-16H2,1-2H3,(H,34,39) |
| InChIKey | BNVXSAVOLYMDCH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|