C19H30N6O2 — CID 69480458
8-(2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl)-9-ethyl-3-methyl-7-(3-methylbut-2-enyl)-8H-purine-2,6-dione (PubChem CID 69480458) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 8-(2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl)-9-ethyl-3-methyl-7-(3-methylbut-2-enyl)-8H-purine-2,6-dione.
| Compound Name | 8-(2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl)-9-ethyl-3-methyl-7-(3-methylbut-2-enyl)-8H-purine-2,6-dione |
|---|---|
| PubChem CID | 69480458 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 8-(2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl)-9-ethyl-3-methyl-7-(3-methylbut-2-enyl)-8H-purine-2,6-dione |
| SMILES | CCN1c2c(c(=O)[nH]c(=O)n2C)N(CC=C(C)C)C1N1CCC2NCCC21 |
| InChI | InChI=1S/C19H30N6O2/c1-5-23-17-15(16(26)21-18(27)22(17)4)25(10-7-12(2)3)19(23)24-11-8-13-14(24)6-9-20-13/h7,13-14,19-20H,5-6,8-11H2,1-4H3,(H,21,26,27) |
| InChIKey | NRWMNDVAKSKQIT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 76.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|