C15H23N5O5 — CID 69480545
2-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]butanoic acid (PubChem CID 69480545) has the molecular formula C15H23N5O5 and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]butanoic acid.
| Compound Name | 2-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 69480545 |
| Molecular Formula | C15H23N5O5 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]butanoic acid |
| SMILES | CCC(C(=O)O)N1CCN(CC2(C)Cn3cc([N+](=O)[O-])nc3O2)CC1 |
| InChI | InChI=1S/C15H23N5O5/c1-3-11(13(21)22)18-6-4-17(5-7-18)9-15(2)10-19-8-12(20(23)24)16-14(19)25-15/h8,11H,3-7,9-10H2,1-2H3,(H,21,22) |
| InChIKey | MCJKMTZGJNZGJH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|