2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid

C6H6ClNO2S — CID 69480659

IUPAC2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid
SMILESCc1nc(CC(=O)O)c(Cl)s1
InChIInChI=1S/C6H6ClNO2S/c1-3-8-4(2-5(9)10)6(7)11-3/h2H2,1H3,(H,9,10)
InChIKeyJDHDFRBRHRGDOT-UHFFFAOYSA-N
MW191.64 g/mol
LogP1.73
Rot. Bonds2

About 2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid

2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid (PubChem CID 69480659) has the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid
PubChem CID69480659
Molecular FormulaC6H6ClNO2S
Molecular Weight191.64 g/mol
Exact Mass190.98
IUPAC Name2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid
SMILESCc1nc(CC(=O)O)c(Cl)s1
InChIInChI=1S/C6H6ClNO2S/c1-3-8-4(2-5(9)10)6(7)11-3/h2H2,1H3,(H,9,10)
InChIKeyJDHDFRBRHRGDOT-UHFFFAOYSA-N
XLogP1.73
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.64
LogP ≤ 51.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid?
The IUPAC name of 2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid (CID 69480659) is 2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid.
What is the SMILES notation for 2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid?
The canonical SMILES for 2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid is Cc1nc(CC(=O)O)c(Cl)s1.
What is the InChIKey of 2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid?
The InChIKey is JDHDFRBRHRGDOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO2S/c1-3-8-4(2-5(9)10)6(7)11-3/h2H2,1H3,(H,9,10).
What are the key properties of 2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid?
2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid has a molecular weight of 191.64 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-2-methyl-1,3-thiazol-4-yl)acetic acid is sourced from PubChem (CID 69480659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).