C18H28O8 — CID 69480817
(3S)-12-ethenyl-3-hydroxy-3-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]cyclododecane-1,2,4-trione (PubChem CID 69480817) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is (3S)-12-ethenyl-3-hydroxy-3-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]cyclododecane-1,2,4-trione.
| Compound Name | (3S)-12-ethenyl-3-hydroxy-3-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]cyclododecane-1,2,4-trione |
|---|---|
| PubChem CID | 69480817 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (3S)-12-ethenyl-3-hydroxy-3-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]cyclododecane-1,2,4-trione |
| SMILES | C=CC1CCCCCCCC(=O)[C@@](O)([C@@H](O)[C@H](O)[C@H](O)CO)C(=O)C1=O |
| InChI | InChI=1S/C18H28O8/c1-2-11-8-6-4-3-5-7-9-13(21)18(26,16(24)14(11)22)17(25)15(23)12(20)10-19/h2,11-12,15,17,19-20,23,25-26H,1,3-10H2/t11?,12-,15-,17+,18+/m1/s1 |
| InChIKey | HNARCFYOGRZGLX-REHUAGCJSA-N |
| XLogP | -0.95 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|