C19H22F3N5O4 — CID 69481149
1-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]-4-[4-(trifluoromethoxy)phenyl]piperidin-2-amine (PubChem CID 69481149) has the molecular formula C19H22F3N5O4 and a molecular weight of 441.41 g/mol. Its IUPAC name is 1-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]-4-[4-(trifluoromethoxy)phenyl]piperidin-2-amine.
| Compound Name | 1-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]-4-[4-(trifluoromethoxy)phenyl]piperidin-2-amine |
|---|---|
| PubChem CID | 69481149 |
| Molecular Formula | C19H22F3N5O4 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 1-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]-4-[4-(trifluoromethoxy)phenyl]piperidin-2-amine |
| SMILES | CC1(CN2CCC(c3ccc(OC(F)(F)F)cc3)CC2N)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C19H22F3N5O4/c1-18(11-26-9-16(27(28)29)24-17(26)31-18)10-25-7-6-13(8-15(25)23)12-2-4-14(5-3-12)30-19(20,21)22/h2-5,9,13,15H,6-8,10-11,23H2,1H3 |
| InChIKey | GUUVBXMFRJKTPE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|