C17H19ClFN5O2 — CID 69481630
6-tert-butyl-8-[2-(4-chloro-3-fluorophenoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 69481630) has the molecular formula C17H19ClFN5O2 and a molecular weight of 379.82 g/mol. Its IUPAC name is 6-tert-butyl-8-[2-(4-chloro-3-fluorophenoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 6-tert-butyl-8-[2-(4-chloro-3-fluorophenoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 69481630 |
| Molecular Formula | C17H19ClFN5O2 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 6-tert-butyl-8-[2-(4-chloro-3-fluorophenoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | CC(C)(C)c1cn2c(=O)[nH]nc2c(NCCOc2ccc(Cl)c(F)c2)n1 |
| InChI | InChI=1S/C17H19ClFN5O2/c1-17(2,3)13-9-24-15(22-23-16(24)25)14(21-13)20-6-7-26-10-4-5-11(18)12(19)8-10/h4-5,8-9H,6-7H2,1-3H3,(H,20,21)(H,23,25) |
| InChIKey | CBBRFPYHTQFPIP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|