C23H44N2O5 — CID 69481883
(3S,4R,6S)-N-hexyl-3,4-dihydroxy-6-methyl-5-(8-methylnonanoylamino)oxane-2-carboxamide (PubChem CID 69481883) has the molecular formula C23H44N2O5 and a molecular weight of 428.61 g/mol. Its IUPAC name is (3S,4R,6S)-N-hexyl-3,4-dihydroxy-6-methyl-5-(8-methylnonanoylamino)oxane-2-carboxamide.
| Compound Name | (3S,4R,6S)-N-hexyl-3,4-dihydroxy-6-methyl-5-(8-methylnonanoylamino)oxane-2-carboxamide |
|---|---|
| PubChem CID | 69481883 |
| Molecular Formula | C23H44N2O5 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (3S,4R,6S)-N-hexyl-3,4-dihydroxy-6-methyl-5-(8-methylnonanoylamino)oxane-2-carboxamide |
| SMILES | CCCCCCNC(=O)C1O[C@@H](C)C(NC(=O)CCCCCCC(C)C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H44N2O5/c1-5-6-7-12-15-24-23(29)22-21(28)20(27)19(17(4)30-22)25-18(26)14-11-9-8-10-13-16(2)3/h16-17,19-22,27-28H,5-15H2,1-4H3,(H,24,29)(H,25,26)/t17-,19?,20+,21-,22?/m0/s1 |
| InChIKey | NBPSBVJRWAPCPV-PVQPSQJQSA-N |
| XLogP | 2.67 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|