C31H29FN4O6 — CID 69482541
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-N-(2-propan-2-yloxyethyl)-1,5-naphthyridine-3-carboxamide (PubChem CID 69482541) has the molecular formula C31H29FN4O6 and a molecular weight of 572.59 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-N-(2-propan-2-yloxyethyl)-1,5-naphthyridine-3-carboxamide.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-N-(2-propan-2-yloxyethyl)-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 69482541 |
| Molecular Formula | C31H29FN4O6 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-N-(2-propan-2-yloxyethyl)-1,5-naphthyridine-3-carboxamide |
| SMILES | CC(C)OCCNC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3)cc2n(CCN2C(=O)c3ccccc3C2=O)c1=O |
| InChI | InChI=1S/C31H29FN4O6/c1-18(2)42-14-11-33-28(38)25-27(37)26-24(16-20(17-34-26)15-19-7-9-21(32)10-8-19)35(31(25)41)12-13-36-29(39)22-5-3-4-6-23(22)30(36)40/h3-10,16-18,37H,11-15H2,1-2H3,(H,33,38) |
| InChIKey | IFNWETVZYZBUBO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|