C33H32FN5O6 — CID 69482713
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-N-(3-morpholin-4-ylpropyl)-2-oxo-1,5-naphthyridine-3-carboxamide (PubChem CID 69482713) has the molecular formula C33H32FN5O6 and a molecular weight of 613.65 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-N-(3-morpholin-4-ylpropyl)-2-oxo-1,5-naphthyridine-3-carboxamide.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-N-(3-morpholin-4-ylpropyl)-2-oxo-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 69482713 |
| Molecular Formula | C33H32FN5O6 |
| Molecular Weight | 613.65 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-N-(3-morpholin-4-ylpropyl)-2-oxo-1,5-naphthyridine-3-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1c(O)c2ncc(Cc3ccc(F)cc3)cc2n(CCN2C(=O)c3ccccc3C2=O)c1=O |
| InChI | InChI=1S/C33H32FN5O6/c34-23-8-6-21(7-9-23)18-22-19-26-28(36-20-22)29(40)27(30(41)35-10-3-11-37-14-16-45-17-15-37)33(44)38(26)12-13-39-31(42)24-4-1-2-5-25(24)32(39)43/h1-2,4-9,19-20,40H,3,10-18H2,(H,35,41) |
| InChIKey | NOFOIUORYGEQEB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.65 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|