C28H40FN7O5 — CID 69483727
2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-1-ium-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine;4-hydroxy-4-oxobut-2-enoate (PubChem CID 69483727) has the molecular formula C28H40FN7O5 and a molecular weight of 573.67 g/mol. Its IUPAC name is 2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-1-ium-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine;4-hydroxy-4-oxobut-2-enoate.
| Compound Name | 2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-1-ium-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine;4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 69483727 |
| Molecular Formula | C28H40FN7O5 |
| Molecular Weight | 573.67 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-1-ium-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine;4-hydroxy-4-oxobut-2-enoate |
| SMILES | CC[NH+]1CCCC1CNc1nc(Nc2ccc(OC)c(F)c2)nc(NC2CCCCCC2)n1.O=C([O-])C=CC(=O)O |
| InChI | InChI=1S/C24H36FN7O.C4H4O4/c1-3-32-14-8-11-19(32)16-26-22-29-23(27-17-9-6-4-5-7-10-17)31-24(30-22)28-18-12-13-21(33-2)20(25)15-18;5-3(6)1-2-4(7)8/h12-13,15,17,19H,3-11,14,16H2,1-2H3,(H3,26,27,28,29,30,31);1-2H,(H,5,6)(H,7,8) |
| InChIKey | FQWJSCNALZIGOU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 165.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.67 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|