About 3,5-difluoroaniline;2-piperidin-4-ylethanol
3,5-difluoroaniline;2-piperidin-4-ylethanol (PubChem CID 69483809) has the molecular formula C13H20F2N2O
and a molecular weight of 258.31 g/mol. Its IUPAC name is 3,5-difluoroaniline;2-piperidin-4-ylethanol.
Molecular Properties
| Compound Name | 3,5-difluoroaniline;2-piperidin-4-ylethanol |
| PubChem CID | 69483809 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3,5-difluoroaniline;2-piperidin-4-ylethanol |
| SMILES | Nc1cc(F)cc(F)c1.OCCC1CCNCC1 |
| InChI | InChI=1S/C7H15NO.C6H5F2N/c9-6-3-7-1-4-8-5-2-7;7-4-1-5(8)3-6(9)2-4/h7-9H,1-6H2;1-3H,9H2 |
| InChIKey | AEDRBHLRTLMFHL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-difluoroaniline;2-piperidin-4-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoroaniline;2-piperidin-4-ylethanol?
The IUPAC name of 3,5-difluoroaniline;2-piperidin-4-ylethanol (CID 69483809) is 3,5-difluoroaniline;2-piperidin-4-ylethanol.
What is the SMILES notation for 3,5-difluoroaniline;2-piperidin-4-ylethanol?
The canonical SMILES for 3,5-difluoroaniline;2-piperidin-4-ylethanol is Nc1cc(F)cc(F)c1.OCCC1CCNCC1.
What is the InChIKey of 3,5-difluoroaniline;2-piperidin-4-ylethanol?
The InChIKey is AEDRBHLRTLMFHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C6H5F2N/c9-6-3-7-1-4-8-5-2-7;7-4-1-5(8)3-6(9)2-4/h7-9H,1-6H2;1-3H,9H2.
What are the key properties of 3,5-difluoroaniline;2-piperidin-4-ylethanol?
3,5-difluoroaniline;2-piperidin-4-ylethanol has a molecular weight of 258.31 g/mol, XLogP of 1.92, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoroaniline;2-piperidin-4-ylethanol is sourced from PubChem (CID 69483809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).