About 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid
2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid (PubChem CID 69483817) has the molecular formula C24H20N2O2S
and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid |
| PubChem CID | 69483817 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid |
| SMILES | O=C(O)CNC(c1ccccc1)(c1ccccc1)c1cccc(-c2cncs2)c1 |
| InChI | InChI=1S/C24H20N2O2S/c27-23(28)16-26-24(19-9-3-1-4-10-19,20-11-5-2-6-12-20)21-13-7-8-18(14-21)22-15-25-17-29-22/h1-15,17,26H,16H2,(H,27,28) |
| InChIKey | MPUXDNCFIQNXTI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid?
The IUPAC name of 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid (CID 69483817) is 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid.
What is the SMILES notation for 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid?
The canonical SMILES for 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid is O=C(O)CNC(c1ccccc1)(c1ccccc1)c1cccc(-c2cncs2)c1.
What is the InChIKey of 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid?
The InChIKey is MPUXDNCFIQNXTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O2S/c27-23(28)16-26-24(19-9-3-1-4-10-19,20-11-5-2-6-12-20)21-13-7-8-18(14-21)22-15-25-17-29-22/h1-15,17,26H,16H2,(H,27,28).
What are the key properties of 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid?
2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid has a molecular weight of 400.50 g/mol, XLogP of 4.78, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[diphenyl-[3-(1,3-thiazol-5-yl)phenyl]methyl]amino]acetic acid is sourced from PubChem (CID 69483817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).