C17H20ClN5O2 — CID 69483899
6-tert-butyl-8-[2-(4-chlorophenoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 69483899) has the molecular formula C17H20ClN5O2 and a molecular weight of 361.83 g/mol. Its IUPAC name is 6-tert-butyl-8-[2-(4-chlorophenoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 6-tert-butyl-8-[2-(4-chlorophenoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 69483899 |
| Molecular Formula | C17H20ClN5O2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 6-tert-butyl-8-[2-(4-chlorophenoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | CC(C)(C)c1cn2c(=O)[nH]nc2c(NCCOc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H20ClN5O2/c1-17(2,3)13-10-23-15(21-22-16(23)24)14(20-13)19-8-9-25-12-6-4-11(18)5-7-12/h4-7,10H,8-9H2,1-3H3,(H,19,20)(H,22,24) |
| InChIKey | DIGUZHNWUABBBK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|