About 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate
1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate (PubChem CID 69483954) has the molecular formula C17H20FN3O6
and a molecular weight of 381.36 g/mol. Its IUPAC name is 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate.
Molecular Properties
| Compound Name | 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate |
| PubChem CID | 69483954 |
| Molecular Formula | C17H20FN3O6 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate |
| SMILES | CCCC(F)OC(=O)C(CCC(N)=O)N1Cc2c(cccc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C17H20FN3O6/c1-2-4-14(18)27-17(24)13(7-8-15(19)22)20-9-11-10(16(20)23)5-3-6-12(11)21(25)26/h3,5-6,13-14H,2,4,7-9H2,1H3,(H2,19,22) |
| InChIKey | BJYHVTGSKFTHEA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate?
The IUPAC name of 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate (CID 69483954) is 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate.
What is the SMILES notation for 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate?
The canonical SMILES for 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate is CCCC(F)OC(=O)C(CCC(N)=O)N1Cc2c(cccc2[N+](=O)[O-])C1=O.
What is the InChIKey of 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate?
The InChIKey is BJYHVTGSKFTHEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FN3O6/c1-2-4-14(18)27-17(24)13(7-8-15(19)22)20-9-11-10(16(20)23)5-3-6-12(11)21(25)26/h3,5-6,13-14H,2,4,7-9H2,1H3,(H2,19,22).
What are the key properties of 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate?
1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate has a molecular weight of 381.36 g/mol, XLogP of 1.82, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorobutyl 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate is sourced from PubChem (CID 69483954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).