About 3-chloroaniline;cyclopropylmethanamine
3-chloroaniline;cyclopropylmethanamine (PubChem CID 69484094) has the molecular formula C10H15ClN2
and a molecular weight of 198.70 g/mol. Its IUPAC name is 3-chloroaniline;cyclopropylmethanamine.
Molecular Properties
| Compound Name | 3-chloroaniline;cyclopropylmethanamine |
| PubChem CID | 69484094 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-chloroaniline;cyclopropylmethanamine |
| SMILES | NCC1CC1.Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C6H6ClN.C4H9N/c7-5-2-1-3-6(8)4-5;5-3-4-1-2-4/h1-4H,8H2;4H,1-3,5H2 |
| InChIKey | FUHCGELCQYYKNH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloroaniline;cyclopropylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloroaniline;cyclopropylmethanamine?
The IUPAC name of 3-chloroaniline;cyclopropylmethanamine (CID 69484094) is 3-chloroaniline;cyclopropylmethanamine.
What is the SMILES notation for 3-chloroaniline;cyclopropylmethanamine?
The canonical SMILES for 3-chloroaniline;cyclopropylmethanamine is NCC1CC1.Nc1cccc(Cl)c1.
What is the InChIKey of 3-chloroaniline;cyclopropylmethanamine?
The InChIKey is FUHCGELCQYYKNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN.C4H9N/c7-5-2-1-3-6(8)4-5;5-3-4-1-2-4/h1-4H,8H2;4H,1-3,5H2.
What are the key properties of 3-chloroaniline;cyclopropylmethanamine?
3-chloroaniline;cyclopropylmethanamine has a molecular weight of 198.70 g/mol, XLogP of 2.28, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloroaniline;cyclopropylmethanamine is sourced from PubChem (CID 69484094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).