About 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine
3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine (PubChem CID 69484133) has the molecular formula C13H19ClFN3
and a molecular weight of 271.77 g/mol. Its IUPAC name is 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine.
Molecular Properties
| Compound Name | 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine |
| PubChem CID | 69484133 |
| Molecular Formula | C13H19ClFN3 |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine |
| SMILES | C=CCN1CCNCC1.Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C7H14N2.C6H5ClFN/c1-2-5-9-6-3-8-4-7-9;7-5-3-4(9)1-2-6(5)8/h2,8H,1,3-7H2;1-3H,9H2 |
| InChIKey | MZQNCNVXHJHFRC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine?
The IUPAC name of 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine (CID 69484133) is 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine.
What is the SMILES notation for 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine?
The canonical SMILES for 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine is C=CCN1CCNCC1.Nc1ccc(F)c(Cl)c1.
What is the InChIKey of 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine?
The InChIKey is MZQNCNVXHJHFRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.C6H5ClFN/c1-2-5-9-6-3-8-4-7-9;7-5-3-4(9)1-2-6(5)8/h2,8H,1,3-7H2;1-3H,9H2.
What are the key properties of 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine?
3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine has a molecular weight of 271.77 g/mol, XLogP of 2.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-fluoroaniline;1-prop-2-enylpiperazine is sourced from PubChem (CID 69484133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).