C22H19N3O3 — CID 69484854
(5R,8aR)-5-phenyl-1,3-dipyridin-4-yl-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[4,3-c][1,4]oxazin-8-one (PubChem CID 69484854) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is (5R,8aR)-5-phenyl-1,3-dipyridin-4-yl-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[4,3-c][1,4]oxazin-8-one.
| Compound Name | (5R,8aR)-5-phenyl-1,3-dipyridin-4-yl-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[4,3-c][1,4]oxazin-8-one |
|---|---|
| PubChem CID | 69484854 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (5R,8aR)-5-phenyl-1,3-dipyridin-4-yl-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[4,3-c][1,4]oxazin-8-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N2C(c3ccncc3)OC(c3ccncc3)[C@H]12 |
| InChI | InChI=1S/C22H19N3O3/c26-22-19-20(16-6-10-23-11-7-16)28-21(17-8-12-24-13-9-17)25(19)18(14-27-22)15-4-2-1-3-5-15/h1-13,18-21H,14H2/t18-,19+,20?,21?/m0/s1 |
| InChIKey | HCEFSXUXEALJAE-KREBGBLKSA-N |
| XLogP | 3.22 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |