C23H34IN7O — CID 69484991
4-[[4-(cycloheptylamino)-6-(1-pyrrolidin-2-ylpropylamino)-1,3,5-triazin-2-yl]amino]-2-iodophenol (PubChem CID 69484991) has the molecular formula C23H34IN7O and a molecular weight of 551.48 g/mol. Its IUPAC name is 4-[[4-(cycloheptylamino)-6-(1-pyrrolidin-2-ylpropylamino)-1,3,5-triazin-2-yl]amino]-2-iodophenol.
| Compound Name | 4-[[4-(cycloheptylamino)-6-(1-pyrrolidin-2-ylpropylamino)-1,3,5-triazin-2-yl]amino]-2-iodophenol |
|---|---|
| PubChem CID | 69484991 |
| Molecular Formula | C23H34IN7O |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 4-[[4-(cycloheptylamino)-6-(1-pyrrolidin-2-ylpropylamino)-1,3,5-triazin-2-yl]amino]-2-iodophenol |
| SMILES | CCC(Nc1nc(Nc2ccc(O)c(I)c2)nc(NC2CCCCCC2)n1)C1CCCN1 |
| InChI | InChI=1S/C23H34IN7O/c1-2-18(19-10-7-13-25-19)28-23-30-21(26-15-8-5-3-4-6-9-15)29-22(31-23)27-16-11-12-20(32)17(24)14-16/h11-12,14-15,18-19,25,32H,2-10,13H2,1H3,(H3,26,27,28,29,30,31) |
| InChIKey | KAAHKSOOOLPKNH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|