C23H34FN7O2 — CID 69485036
2-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-N-[3-(fluoromethoxy)phenyl]-4-N-(oxan-4-ylmethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 69485036) has the molecular formula C23H34FN7O2 and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-N-[3-(fluoromethoxy)phenyl]-4-N-(oxan-4-ylmethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-N-[3-(fluoromethoxy)phenyl]-4-N-(oxan-4-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 69485036 |
| Molecular Formula | C23H34FN7O2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 2-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-N-[3-(fluoromethoxy)phenyl]-4-N-(oxan-4-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN1CCCC1CN(c1cccc(OCF)c1)c1nc(N)nc(NCC2CCOCC2)n1 |
| InChI | InChI=1S/C23H34FN7O2/c1-2-30-10-4-6-19(30)15-31(18-5-3-7-20(13-18)33-16-24)23-28-21(25)27-22(29-23)26-14-17-8-11-32-12-9-17/h3,5,7,13,17,19H,2,4,6,8-12,14-16H2,1H3,(H3,25,26,27,28,29) |
| InChIKey | FTHRYMFQKRMETP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |