C10H16O3 — CID 69485387
1,2,6-trimethoxy-4-methylcyclohexa-1,3-diene (PubChem CID 69485387) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 1,2,6-trimethoxy-4-methylcyclohexa-1,3-diene.
| Compound Name | 1,2,6-trimethoxy-4-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 69485387 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1,2,6-trimethoxy-4-methylcyclohexa-1,3-diene |
| SMILES | COC1=C(OC)C(OC)CC(C)=C1 |
| InChI | InChI=1S/C10H16O3/c1-7-5-8(11-2)10(13-4)9(6-7)12-3/h5,9H,6H2,1-4H3 |
| InChIKey | JOSCERLNIVOBSE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |