C13H14N2O6 — CID 69486201
(2R,3S,4R)-2-(hydroxymethyl)-5-(5-nitro-1H-indol-3-yl)oxolane-3,4-diol (PubChem CID 69486201) has the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-(5-nitro-1H-indol-3-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-(5-nitro-1H-indol-3-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 69486201 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-(5-nitro-1H-indol-3-yl)oxolane-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc2[nH]cc(C3O[C@H](CO)[C@@H](O)[C@H]3O)c2c1 |
| InChI | InChI=1S/C13H14N2O6/c16-5-10-11(17)12(18)13(21-10)8-4-14-9-2-1-6(15(19)20)3-7(8)9/h1-4,10-14,16-18H,5H2/t10-,11-,12-,13?/m1/s1 |
| InChIKey | GUCQGWGWFCFQDF-PFGBXZAXSA-N |
| XLogP | 0.23 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|