C16H22N2O5 — CID 69486207
8-hydroxy-9-methyl-5-(2-methylpropyl)-7-nitro-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid (PubChem CID 69486207) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 8-hydroxy-9-methyl-5-(2-methylpropyl)-7-nitro-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid.
| Compound Name | 8-hydroxy-9-methyl-5-(2-methylpropyl)-7-nitro-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 69486207 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 8-hydroxy-9-methyl-5-(2-methylpropyl)-7-nitro-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid |
| SMILES | Cc1c(O)c([N+](=O)[O-])cc2c1CCN(C(=O)O)CC2CC(C)C |
| InChI | InChI=1S/C16H22N2O5/c1-9(2)6-11-8-17(16(20)21)5-4-12-10(3)15(19)14(18(22)23)7-13(11)12/h7,9,11,19H,4-6,8H2,1-3H3,(H,20,21) |
| InChIKey | YLYPVLAISOYLGQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|