C21H28F3N3O — CID 69486316
8-[(1R,2R)-2-phenylcyclohexyl]-1-(2,2,2-trifluoroethyl)-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 69486316) has the molecular formula C21H28F3N3O and a molecular weight of 395.47 g/mol. Its IUPAC name is 8-[(1R,2R)-2-phenylcyclohexyl]-1-(2,2,2-trifluoroethyl)-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[(1R,2R)-2-phenylcyclohexyl]-1-(2,2,2-trifluoroethyl)-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 69486316 |
| Molecular Formula | C21H28F3N3O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 8-[(1R,2R)-2-phenylcyclohexyl]-1-(2,2,2-trifluoroethyl)-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C1NCN(CC(F)(F)F)C12CCN([C@@H]1CCCC[C@@H]1c1ccccc1)CC2 |
| InChI | InChI=1S/C21H28F3N3O/c22-21(23,24)14-27-15-25-19(28)20(27)10-12-26(13-11-20)18-9-5-4-8-17(18)16-6-2-1-3-7-16/h1-3,6-7,17-18H,4-5,8-15H2,(H,25,28)/t17-,18-/m1/s1 |
| InChIKey | PRXGTAWUQKHDLM-QZTJIDSGSA-N |
| XLogP | 3.50 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |